C8H10O3 — CID 130038229
6,6-dimethyl-4,8-dioxatricyclo[5.1.0.03,5]octan-2-one (PubChem CID 130038229) has the molecular formula C8H10O3 and a molecular weight of 154.16 g/mol. Its IUPAC name is 6,6-dimethyl-4,8-dioxatricyclo[5.1.0.03,5]octan-2-one.
| Compound Name | 6,6-dimethyl-4,8-dioxatricyclo[5.1.0.03,5]octan-2-one |
|---|---|
| PubChem CID | 130038229 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 6,6-dimethyl-4,8-dioxatricyclo[5.1.0.03,5]octan-2-one |
| SMILES | CC1(C)C2OC2C(=O)C2OC21 |
| InChI | InChI=1S/C8H10O3/c1-8(2)6-4(10-6)3(9)5-7(8)11-5/h4-7H,1-2H3 |
| InChIKey | DFHKOPQVJCEVJG-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 42.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|