C16H19NO3 — CID 102488013
(1S,2S,4S,6R,7R,11R,12S)-7,15-dimethyl-3,8-dioxa-15-azahexacyclo[9.4.2.01,12.02,4.06,12.07,11]heptadec-9-en-5-one (PubChem CID 102488013) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is (1S,2S,4S,6R,7R,11R,12S)-7,15-dimethyl-3,8-dioxa-15-azahexacyclo[9.4.2.01,12.02,4.06,12.07,11]heptadec-9-en-5-one.
| Compound Name | (1S,2S,4S,6R,7R,11R,12S)-7,15-dimethyl-3,8-dioxa-15-azahexacyclo[9.4.2.01,12.02,4.06,12.07,11]heptadec-9-en-5-one |
|---|---|
| PubChem CID | 102488013 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | (1S,2S,4S,6R,7R,11R,12S)-7,15-dimethyl-3,8-dioxa-15-azahexacyclo[9.4.2.01,12.02,4.06,12.07,11]heptadec-9-en-5-one |
| SMILES | CN1CC[C@@]23[C@H]4C(=O)[C@H]5O[C@H]5[C@@]12CC[C@@]31C=CO[C@]41C |
| InChI | InChI=1S/C16H19NO3/c1-13-11-9(18)10-12(20-10)16-4-3-14(13,6-8-19-13)15(11,16)5-7-17(16)2/h6,8,10-12H,3-5,7H2,1-2H3/t10-,11+,12-,13-,14+,15+,16-/m1/s1 |
| InChIKey | NQBZTPRMQXZANC-BXBLUMELSA-N |
| XLogP | 1.11 |
| TPSA | 42.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|