C6H6F2N2O — CID 130057595
4,5-diamino-2,3-difluorophenol (PubChem CID 130057595) has the molecular formula C6H6F2N2O and a molecular weight of 160.12 g/mol. Its IUPAC name is 4,5-diamino-2,3-difluorophenol.
| Compound Name | 4,5-diamino-2,3-difluorophenol |
|---|---|
| PubChem CID | 130057595 |
| Molecular Formula | C6H6F2N2O |
| Molecular Weight | 160.12 g/mol |
| Exact Mass | 160.04 |
| IUPAC Name | 4,5-diamino-2,3-difluorophenol |
| SMILES | Nc1cc(O)c(F)c(F)c1N |
| InChI | InChI=1S/C6H6F2N2O/c7-4-3(11)1-2(9)6(10)5(4)8/h1,11H,9-10H2 |
| InChIKey | AJSYIUAFTPAPTL-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.12 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|