About methyl 2-hydroxypentanimidate
methyl 2-hydroxypentanimidate (PubChem CID 130126876) has the molecular formula C6H13NO2
and a molecular weight of 131.17 g/mol. Its IUPAC name is methyl 2-hydroxypentanimidate.
Molecular Properties
| Compound Name | methyl 2-hydroxypentanimidate |
| PubChem CID | 130126876 |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 131.17 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | methyl 2-hydroxypentanimidate |
| SMILES | [H]/N=C(\OC)C(O)CCC |
| InChI | InChI=1S/C6H13NO2/c1-3-4-5(8)6(7)9-2/h5,7-8H,3-4H2,1-2H3/b7-6- |
| InChIKey | BQZLQEFSVRLZMT-SREVYHEPSA-N |
| XLogP | 0.77 |
| TPSA | 53.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.17 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-hydroxypentanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-hydroxypentanimidate?
The IUPAC name of methyl 2-hydroxypentanimidate (CID 130126876) is methyl 2-hydroxypentanimidate.
What is the SMILES notation for methyl 2-hydroxypentanimidate?
The canonical SMILES for methyl 2-hydroxypentanimidate is [H]/N=C(\OC)C(O)CCC.
What is the InChIKey of methyl 2-hydroxypentanimidate?
The InChIKey is BQZLQEFSVRLZMT-SREVYHEPSA-N. The full InChI is InChI=1S/C6H13NO2/c1-3-4-5(8)6(7)9-2/h5,7-8H,3-4H2,1-2H3/b7-6-.
What are the key properties of methyl 2-hydroxypentanimidate?
methyl 2-hydroxypentanimidate has a molecular weight of 131.17 g/mol, XLogP of 0.77, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-hydroxypentanimidate is sourced from PubChem (CID 130126876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).