About methyl 2-methoxypentanimidate
methyl 2-methoxypentanimidate (PubChem CID 116727295) has the molecular formula C7H15NO2
and a molecular weight of 145.20 g/mol. Its IUPAC name is methyl 2-methoxypentanimidate.
Molecular Properties
| Compound Name | methyl 2-methoxypentanimidate |
| PubChem CID | 116727295 |
| Molecular Formula | C7H15NO2 |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.11 |
| IUPAC Name | methyl 2-methoxypentanimidate |
| SMILES | [H]/N=C(\OC)C(CCC)OC |
| InChI | InChI=1S/C7H15NO2/c1-4-5-6(9-2)7(8)10-3/h6,8H,4-5H2,1-3H3/b8-7- |
| InChIKey | DHDORCAHONNJLS-FPLPWBNLSA-N |
| XLogP | 1.43 |
| TPSA | 42.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-methoxypentanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-methoxypentanimidate?
The IUPAC name of methyl 2-methoxypentanimidate (CID 116727295) is methyl 2-methoxypentanimidate.
What is the SMILES notation for methyl 2-methoxypentanimidate?
The canonical SMILES for methyl 2-methoxypentanimidate is [H]/N=C(\OC)C(CCC)OC.
What is the InChIKey of methyl 2-methoxypentanimidate?
The InChIKey is DHDORCAHONNJLS-FPLPWBNLSA-N. The full InChI is InChI=1S/C7H15NO2/c1-4-5-6(9-2)7(8)10-3/h6,8H,4-5H2,1-3H3/b8-7-.
What are the key properties of methyl 2-methoxypentanimidate?
methyl 2-methoxypentanimidate has a molecular weight of 145.20 g/mol, XLogP of 1.43, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methoxypentanimidate is sourced from PubChem (CID 116727295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).