C11H24N2O — CID 116732421
2-ethoxy-N,N-diethylpentanimidamide (PubChem CID 116732421) has the molecular formula C11H24N2O and a molecular weight of 200.33 g/mol. Its IUPAC name is 2-ethoxy-N,N-diethylpentanimidamide.
| Compound Name | 2-ethoxy-N,N-diethylpentanimidamide |
|---|---|
| PubChem CID | 116732421 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | 2-ethoxy-N,N-diethylpentanimidamide |
| SMILES | [H]/N=C(/C(CCC)OCC)N(CC)CC |
| InChI | InChI=1S/C11H24N2O/c1-5-9-10(14-8-4)11(12)13(6-2)7-3/h10,12H,5-9H2,1-4H3/b12-11- |
| InChIKey | NXDTVNVACTXZEO-QXMHVHEDSA-N |
| XLogP | 2.51 |
| TPSA | 36.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|