C6H9NO4 — CID 130129765
1-(1,2-dihydroxyethyl)pyrrolidine-2,5-dione (PubChem CID 130129765) has the molecular formula C6H9NO4 and a molecular weight of 159.14 g/mol. Its IUPAC name is 1-(1,2-dihydroxyethyl)pyrrolidine-2,5-dione.
| Compound Name | 1-(1,2-dihydroxyethyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 130129765 |
| Molecular Formula | C6H9NO4 |
| Molecular Weight | 159.14 g/mol |
| Exact Mass | 159.05 |
| IUPAC Name | 1-(1,2-dihydroxyethyl)pyrrolidine-2,5-dione |
| SMILES | O=C1CCC(=O)N1C(O)CO |
| InChI | InChI=1S/C6H9NO4/c8-3-6(11)7-4(9)1-2-5(7)10/h6,8,11H,1-3H2 |
| InChIKey | UTTSDDWNISTCCG-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.14 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|