About (2,5-dioxopyrrol-1-yl) (2S)-2-(2,5-dioxopyrrolidin-1-yl)-3-hydroxypropanoate
(2,5-dioxopyrrol-1-yl) (2S)-2-(2,5-dioxopyrrolidin-1-yl)-3-hydroxypropanoate (PubChem CID 167101297) has the molecular formula C11H10N2O7
and a molecular weight of 282.21 g/mol. Its IUPAC name is (2,5-dioxopyrrol-1-yl) (2S)-2-(2,5-dioxopyrrolidin-1-yl)-3-hydroxypropanoate.
Molecular Properties
| Compound Name | (2,5-dioxopyrrol-1-yl) (2S)-2-(2,5-dioxopyrrolidin-1-yl)-3-hydroxypropanoate |
| PubChem CID | 167101297 |
| Molecular Formula | C11H10N2O7 |
| Molecular Weight | 282.21 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | (2,5-dioxopyrrol-1-yl) (2S)-2-(2,5-dioxopyrrolidin-1-yl)-3-hydroxypropanoate |
| SMILES | O=C(ON1C(=O)C=CC1=O)[C@H](CO)N1C(=O)CCC1=O |
| InChI | InChI=1S/C11H10N2O7/c14-5-6(12-7(15)1-2-8(12)16)11(19)20-13-9(17)3-4-10(13)18/h3-4,6,14H,1-2,5H2/t6-/m0/s1 |
| InChIKey | ALMRZIFJHFNGTP-LURJTMIESA-N |
| XLogP | -2.12 |
| TPSA | 121.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.21 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dioxopyrrol-1-yl) (2S)-2-(2,5-dioxopyrrolidin-1-yl)-3-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dioxopyrrol-1-yl) (2S)-2-(2,5-dioxopyrrolidin-1-yl)-3-hydroxypropanoate?
The IUPAC name of (2,5-dioxopyrrol-1-yl) (2S)-2-(2,5-dioxopyrrolidin-1-yl)-3-hydroxypropanoate (CID 167101297) is (2,5-dioxopyrrol-1-yl) (2S)-2-(2,5-dioxopyrrolidin-1-yl)-3-hydroxypropanoate.
What is the SMILES notation for (2,5-dioxopyrrol-1-yl) (2S)-2-(2,5-dioxopyrrolidin-1-yl)-3-hydroxypropanoate?
The canonical SMILES for (2,5-dioxopyrrol-1-yl) (2S)-2-(2,5-dioxopyrrolidin-1-yl)-3-hydroxypropanoate is O=C(ON1C(=O)C=CC1=O)[C@H](CO)N1C(=O)CCC1=O.
What is the InChIKey of (2,5-dioxopyrrol-1-yl) (2S)-2-(2,5-dioxopyrrolidin-1-yl)-3-hydroxypropanoate?
The InChIKey is ALMRZIFJHFNGTP-LURJTMIESA-N. The full InChI is InChI=1S/C11H10N2O7/c14-5-6(12-7(15)1-2-8(12)16)11(19)20-13-9(17)3-4-10(13)18/h3-4,6,14H,1-2,5H2/t6-/m0/s1.
What are the key properties of (2,5-dioxopyrrol-1-yl) (2S)-2-(2,5-dioxopyrrolidin-1-yl)-3-hydroxypropanoate?
(2,5-dioxopyrrol-1-yl) (2S)-2-(2,5-dioxopyrrolidin-1-yl)-3-hydroxypropanoate has a molecular weight of 282.21 g/mol, XLogP of -2.12, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dioxopyrrol-1-yl) (2S)-2-(2,5-dioxopyrrolidin-1-yl)-3-hydroxypropanoate is sourced from PubChem (CID 167101297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).