C9H15N3O9 — CID 139662518
1,3,5-tris(1,2-dihydroxyethyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 139662518) has the molecular formula C9H15N3O9 and a molecular weight of 309.23 g/mol. Its IUPAC name is 1,3,5-tris(1,2-dihydroxyethyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3,5-tris(1,2-dihydroxyethyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 139662518 |
| Molecular Formula | C9H15N3O9 |
| Molecular Weight | 309.23 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 1,3,5-tris(1,2-dihydroxyethyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | O=c1n(C(O)CO)c(=O)n(C(O)CO)c(=O)n1C(O)CO |
| InChI | InChI=1S/C9H15N3O9/c13-1-4(16)10-7(19)11(5(17)2-14)9(21)12(8(10)20)6(18)3-15/h4-6,13-18H,1-3H2 |
| InChIKey | AZGNSQDUAJRWMY-UHFFFAOYSA-N |
| XLogP | -5.38 |
| TPSA | 187.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.23 |
| LogP ≤ 5 | -5.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |