C5H7N3O6 — CID 67709709
1-(1,2,2-trihydroxyethyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 67709709) has the molecular formula C5H7N3O6 and a molecular weight of 205.13 g/mol. Its IUPAC name is 1-(1,2,2-trihydroxyethyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-(1,2,2-trihydroxyethyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 67709709 |
| Molecular Formula | C5H7N3O6 |
| Molecular Weight | 205.13 g/mol |
| Exact Mass | 205.03 |
| IUPAC Name | 1-(1,2,2-trihydroxyethyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | O=c1[nH]c(=O)n(C(O)C(O)O)c(=O)[nH]1 |
| InChI | InChI=1S/C5H7N3O6/c9-1(2(10)11)8-4(13)6-3(12)7-5(8)14/h1-2,9-11H,(H2,6,7,12,13,14) |
| InChIKey | UPJLYLVKOZSZJK-UHFFFAOYSA-N |
| XLogP | -3.97 |
| TPSA | 148.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.13 |
| LogP ≤ 5 | -3.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|