C7H14N2O7 — CID 21219852
1,3-bis(2,2-dihydroxyethyl)-4,5-dihydroxyimidazolidin-2-one (PubChem CID 21219852) has the molecular formula C7H14N2O7 and a molecular weight of 238.20 g/mol. Its IUPAC name is 1,3-bis(2,2-dihydroxyethyl)-4,5-dihydroxyimidazolidin-2-one.
| Compound Name | 1,3-bis(2,2-dihydroxyethyl)-4,5-dihydroxyimidazolidin-2-one |
|---|---|
| PubChem CID | 21219852 |
| Molecular Formula | C7H14N2O7 |
| Molecular Weight | 238.20 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 1,3-bis(2,2-dihydroxyethyl)-4,5-dihydroxyimidazolidin-2-one |
| SMILES | O=C1N(CC(O)O)C(O)C(O)N1CC(O)O |
| InChI | InChI=1S/C7H14N2O7/c10-3(11)1-8-5(14)6(15)9(7(8)16)2-4(12)13/h3-6,10-15H,1-2H2 |
| InChIKey | VQGZLZSTTBGSKH-UHFFFAOYSA-N |
| XLogP | -4.02 |
| TPSA | 144.93 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.20 |
| LogP ≤ 5 | -4.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|