C10H11N — CID 130136162
8-azatricyclo[5.4.0.02,6]undeca-2,4,6-triene (PubChem CID 130136162) has the molecular formula C10H11N and a molecular weight of 145.21 g/mol. Its IUPAC name is 8-azatricyclo[5.4.0.02,6]undeca-2,4,6-triene.
| Compound Name | 8-azatricyclo[5.4.0.02,6]undeca-2,4,6-triene |
|---|---|
| PubChem CID | 130136162 |
| Molecular Formula | C10H11N |
| Molecular Weight | 145.21 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | 8-azatricyclo[5.4.0.02,6]undeca-2,4,6-triene |
| SMILES | C1=CC2=C3NCCCC3C2=C1 |
| InChI | InChI=1S/C10H11N/c1-3-7-8(4-1)10-9(7)5-2-6-11-10/h1,3-4,9,11H,2,5-6H2 |
| InChIKey | RSUCALWWJJJVKO-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.21 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |