C9H14N2 — CID 154392905
1,2,3,4,4a,5-hexahydroquinolin-5-amine (PubChem CID 154392905) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is 1,2,3,4,4a,5-hexahydroquinolin-5-amine.
| Compound Name | 1,2,3,4,4a,5-hexahydroquinolin-5-amine |
|---|---|
| PubChem CID | 154392905 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 1,2,3,4,4a,5-hexahydroquinolin-5-amine |
| SMILES | NC1C=CC=C2NCCCC21 |
| InChI | InChI=1S/C9H14N2/c10-8-4-1-5-9-7(8)3-2-6-11-9/h1,4-5,7-8,11H,2-3,6,10H2 |
| InChIKey | AUJMANGETPMDCF-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |