C7H6Cl3N3S — CID 130154547
(2,4,5-trichloroanilino)thiourea (PubChem CID 130154547) has the molecular formula C7H6Cl3N3S and a molecular weight of 270.57 g/mol. Its IUPAC name is (2,4,5-trichloroanilino)thiourea.
| Compound Name | (2,4,5-trichloroanilino)thiourea |
|---|---|
| PubChem CID | 130154547 |
| Molecular Formula | C7H6Cl3N3S |
| Molecular Weight | 270.57 g/mol |
| Exact Mass | 268.93 |
| IUPAC Name | (2,4,5-trichloroanilino)thiourea |
| SMILES | NC(=S)NNc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C7H6Cl3N3S/c8-3-1-5(10)6(2-4(3)9)12-13-7(11)14/h1-2,12H,(H3,11,13,14) |
| InChIKey | JTHWULIQCRJJPD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.57 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|