1-chloro-2-(2,4,5-trichlorophenyl)hydrazine;phosphoric acid

C6H7Cl4N2O4P — CID 174886932

IUPAC1-chloro-2-(2,4,5-trichlorophenyl)hydrazine;phosphoric acid
SMILESClNNc1cc(Cl)c(Cl)cc1Cl.O=P(O)(O)O
InChIInChI=1S/C6H4Cl4N2.H3O4P/c7-3-1-5(9)6(11-12-10)2-4(3)8;1-5(2,3)4/h1-2,11-12H;(H3,1,2,3,4)
InChIKeyLTLQDWMYWODUIT-UHFFFAOYSA-N
MW343.92 g/mol
LogP2.79
Rot. Bonds2

About 1-chloro-2-(2,4,5-trichlorophenyl)hydrazine;phosphoric acid

1-chloro-2-(2,4,5-trichlorophenyl)hydrazine;phosphoric acid (PubChem CID 174886932) has the molecular formula C6H7Cl4N2O4P and a molecular weight of 343.92 g/mol. Its IUPAC name is 1-chloro-2-(2,4,5-trichlorophenyl)hydrazine;phosphoric acid.

Molecular Properties

Compound Name1-chloro-2-(2,4,5-trichlorophenyl)hydrazine;phosphoric acid
PubChem CID174886932
Molecular FormulaC6H7Cl4N2O4P
Molecular Weight343.92 g/mol
Exact Mass341.89
IUPAC Name1-chloro-2-(2,4,5-trichlorophenyl)hydrazine;phosphoric acid
SMILESClNNc1cc(Cl)c(Cl)cc1Cl.O=P(O)(O)O
InChIInChI=1S/C6H4Cl4N2.H3O4P/c7-3-1-5(9)6(11-12-10)2-4(3)8;1-5(2,3)4/h1-2,11-12H;(H3,1,2,3,4)
InChIKeyLTLQDWMYWODUIT-UHFFFAOYSA-N
XLogP2.79
TPSA101.82 Ų
H-Bond Donors5
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500343.92
LogP ≤ 52.79
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze 1-chloro-2-(2,4,5-trichlorophenyl)hydrazine;phosphoric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-chloro-2-(2,4,5-trichlorophenyl)hydrazine;phosphoric acid?
The IUPAC name of 1-chloro-2-(2,4,5-trichlorophenyl)hydrazine;phosphoric acid (CID 174886932) is 1-chloro-2-(2,4,5-trichlorophenyl)hydrazine;phosphoric acid.
What is the SMILES notation for 1-chloro-2-(2,4,5-trichlorophenyl)hydrazine;phosphoric acid?
The canonical SMILES for 1-chloro-2-(2,4,5-trichlorophenyl)hydrazine;phosphoric acid is ClNNc1cc(Cl)c(Cl)cc1Cl.O=P(O)(O)O.
What is the InChIKey of 1-chloro-2-(2,4,5-trichlorophenyl)hydrazine;phosphoric acid?
The InChIKey is LTLQDWMYWODUIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4Cl4N2.H3O4P/c7-3-1-5(9)6(11-12-10)2-4(3)8;1-5(2,3)4/h1-2,11-12H;(H3,1,2,3,4).
What are the key properties of 1-chloro-2-(2,4,5-trichlorophenyl)hydrazine;phosphoric acid?
1-chloro-2-(2,4,5-trichlorophenyl)hydrazine;phosphoric acid has a molecular weight of 343.92 g/mol, XLogP of 2.79, 2 rotatable bonds, 5 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2-(2,4,5-trichlorophenyl)hydrazine;phosphoric acid is sourced from PubChem (CID 174886932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).