C6H7Cl4N2O4P — CID 174886932
1-chloro-2-(2,4,5-trichlorophenyl)hydrazine;phosphoric acid (PubChem CID 174886932) has the molecular formula C6H7Cl4N2O4P and a molecular weight of 343.92 g/mol. Its IUPAC name is 1-chloro-2-(2,4,5-trichlorophenyl)hydrazine;phosphoric acid.
| Compound Name | 1-chloro-2-(2,4,5-trichlorophenyl)hydrazine;phosphoric acid |
|---|---|
| PubChem CID | 174886932 |
| Molecular Formula | C6H7Cl4N2O4P |
| Molecular Weight | 343.92 g/mol |
| Exact Mass | 341.89 |
| IUPAC Name | 1-chloro-2-(2,4,5-trichlorophenyl)hydrazine;phosphoric acid |
| SMILES | ClNNc1cc(Cl)c(Cl)cc1Cl.O=P(O)(O)O |
| InChI | InChI=1S/C6H4Cl4N2.H3O4P/c7-3-1-5(9)6(11-12-10)2-4(3)8;1-5(2,3)4/h1-2,11-12H;(H3,1,2,3,4) |
| InChIKey | LTLQDWMYWODUIT-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.92 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|