C6H8Cl3N2O4P — CID 138619519
phosphoric acid;(2,4,5-trichlorophenyl)hydrazine (PubChem CID 138619519) has the molecular formula C6H8Cl3N2O4P and a molecular weight of 309.47 g/mol. Its IUPAC name is phosphoric acid;(2,4,5-trichlorophenyl)hydrazine.
| Compound Name | phosphoric acid;(2,4,5-trichlorophenyl)hydrazine |
|---|---|
| PubChem CID | 138619519 |
| Molecular Formula | C6H8Cl3N2O4P |
| Molecular Weight | 309.47 g/mol |
| Exact Mass | 307.93 |
| IUPAC Name | phosphoric acid;(2,4,5-trichlorophenyl)hydrazine |
| SMILES | NNc1cc(Cl)c(Cl)cc1Cl.O=P(O)(O)O |
| InChI | InChI=1S/C6H5Cl3N2.H3O4P/c7-3-1-5(9)6(11-10)2-4(3)8;1-5(2,3)4/h1-2,11H,10H2;(H3,1,2,3,4) |
| InChIKey | VGZYFSUZXARBRR-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.47 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|