C6H5Cl3NO3P — CID 71424047
(2,4,5-trichloroanilino)phosphonic acid (PubChem CID 71424047) has the molecular formula C6H5Cl3NO3P and a molecular weight of 276.44 g/mol. Its IUPAC name is (2,4,5-trichloroanilino)phosphonic acid.
| Compound Name | (2,4,5-trichloroanilino)phosphonic acid |
|---|---|
| PubChem CID | 71424047 |
| Molecular Formula | C6H5Cl3NO3P |
| Molecular Weight | 276.44 g/mol |
| Exact Mass | 274.91 |
| IUPAC Name | (2,4,5-trichloroanilino)phosphonic acid |
| SMILES | O=P(O)(O)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C6H5Cl3NO3P/c7-3-1-5(9)6(2-4(3)8)10-14(11,12)13/h1-2H,(H3,10,11,12,13) |
| InChIKey | PYUQUYFSUXWXEH-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.44 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|