C10H16N4O3S — CID 130187539
[4-(4-methylpyrazole-1-carbonyl)piperazin-1-yl]methanesulfinic acid (PubChem CID 130187539) has the molecular formula C10H16N4O3S and a molecular weight of 272.33 g/mol. Its IUPAC name is [4-(4-methylpyrazole-1-carbonyl)piperazin-1-yl]methanesulfinic acid.
| Compound Name | [4-(4-methylpyrazole-1-carbonyl)piperazin-1-yl]methanesulfinic acid |
|---|---|
| PubChem CID | 130187539 |
| Molecular Formula | C10H16N4O3S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | [4-(4-methylpyrazole-1-carbonyl)piperazin-1-yl]methanesulfinic acid |
| SMILES | Cc1cnn(C(=O)N2CCN(CS(=O)O)CC2)c1 |
| InChI | InChI=1S/C10H16N4O3S/c1-9-6-11-14(7-9)10(15)13-4-2-12(3-5-13)8-18(16)17/h6-7H,2-5,8H2,1H3,(H,16,17) |
| InChIKey | ZZDXBCBMEGJJJQ-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|