C36H24Br4N2 — CID 130200071
4-[4-amino-2,3-bis(4-bromophenyl)phenyl]-2,3-bis(4-bromophenyl)aniline (PubChem CID 130200071) has the molecular formula C36H24Br4N2 and a molecular weight of 804.22 g/mol. Its IUPAC name is 4-[4-amino-2,3-bis(4-bromophenyl)phenyl]-2,3-bis(4-bromophenyl)aniline.
| Compound Name | 4-[4-amino-2,3-bis(4-bromophenyl)phenyl]-2,3-bis(4-bromophenyl)aniline |
|---|---|
| PubChem CID | 130200071 |
| Molecular Formula | C36H24Br4N2 |
| Molecular Weight | 804.22 g/mol |
| Exact Mass | 799.87 |
| IUPAC Name | 4-[4-amino-2,3-bis(4-bromophenyl)phenyl]-2,3-bis(4-bromophenyl)aniline |
| SMILES | Nc1ccc(-c2ccc(N)c(-c3ccc(Br)cc3)c2-c2ccc(Br)cc2)c(-c2ccc(Br)cc2)c1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C36H24Br4N2/c37-25-9-1-21(2-10-25)33-29(17-19-31(41)35(33)23-5-13-27(39)14-6-23)30-18-20-32(42)36(24-7-15-28(40)16-8-24)34(30)22-3-11-26(38)12-4-22/h1-20H,41-42H2 |
| InChIKey | UJPTZDZIVCZXSM-UHFFFAOYSA-N |
| XLogP | 12.24 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.22 |
| LogP ≤ 5 | 12.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|