About (8-methyl-6,7-dioxononyl) thiocyanate
(8-methyl-6,7-dioxononyl) thiocyanate (PubChem CID 130201602) has the molecular formula C11H17NO2S
and a molecular weight of 227.33 g/mol. Its IUPAC name is (8-methyl-6,7-dioxononyl) thiocyanate.
Molecular Properties
| Compound Name | (8-methyl-6,7-dioxononyl) thiocyanate |
| PubChem CID | 130201602 |
| Molecular Formula | C11H17NO2S |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | (8-methyl-6,7-dioxononyl) thiocyanate |
| SMILES | CC(C)C(=O)C(=O)CCCCCSC#N |
| InChI | InChI=1S/C11H17NO2S/c1-9(2)11(14)10(13)6-4-3-5-7-15-8-12/h9H,3-7H2,1-2H3 |
| InChIKey | BSYHOKGLJBNBOE-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze (8-methyl-6,7-dioxononyl) thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8-methyl-6,7-dioxononyl) thiocyanate?
The IUPAC name of (8-methyl-6,7-dioxononyl) thiocyanate (CID 130201602) is (8-methyl-6,7-dioxononyl) thiocyanate.
What is the SMILES notation for (8-methyl-6,7-dioxononyl) thiocyanate?
The canonical SMILES for (8-methyl-6,7-dioxononyl) thiocyanate is CC(C)C(=O)C(=O)CCCCCSC#N.
What is the InChIKey of (8-methyl-6,7-dioxononyl) thiocyanate?
The InChIKey is BSYHOKGLJBNBOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO2S/c1-9(2)11(14)10(13)6-4-3-5-7-15-8-12/h9H,3-7H2,1-2H3.
What are the key properties of (8-methyl-6,7-dioxononyl) thiocyanate?
(8-methyl-6,7-dioxononyl) thiocyanate has a molecular weight of 227.33 g/mol, XLogP of 2.56, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (8-methyl-6,7-dioxononyl) thiocyanate is sourced from PubChem (CID 130201602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).