About 9-methylsulfinylnonyl thiocyanate
9-methylsulfinylnonyl thiocyanate (PubChem CID 141341789) has the molecular formula C11H21NOS2
and a molecular weight of 247.43 g/mol. Its IUPAC name is 9-methylsulfinylnonyl thiocyanate.
Molecular Properties
| Compound Name | 9-methylsulfinylnonyl thiocyanate |
| PubChem CID | 141341789 |
| Molecular Formula | C11H21NOS2 |
| Molecular Weight | 247.43 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 9-methylsulfinylnonyl thiocyanate |
| SMILES | CS(=O)CCCCCCCCCSC#N |
| InChI | InChI=1S/C11H21NOS2/c1-15(13)10-8-6-4-2-3-5-7-9-14-11-12/h2-10H2,1H3 |
| InChIKey | SLUHXWOIHOURSA-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.43 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze 9-methylsulfinylnonyl thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methylsulfinylnonyl thiocyanate?
The IUPAC name of 9-methylsulfinylnonyl thiocyanate (CID 141341789) is 9-methylsulfinylnonyl thiocyanate.
What is the SMILES notation for 9-methylsulfinylnonyl thiocyanate?
The canonical SMILES for 9-methylsulfinylnonyl thiocyanate is CS(=O)CCCCCCCCCSC#N.
What is the InChIKey of 9-methylsulfinylnonyl thiocyanate?
The InChIKey is SLUHXWOIHOURSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NOS2/c1-15(13)10-8-6-4-2-3-5-7-9-14-11-12/h2-10H2,1H3.
What are the key properties of 9-methylsulfinylnonyl thiocyanate?
9-methylsulfinylnonyl thiocyanate has a molecular weight of 247.43 g/mol, XLogP of 3.31, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methylsulfinylnonyl thiocyanate is sourced from PubChem (CID 141341789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).