C20H31NO5 — CID 130209837
5-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]-2,3,3-trimethylindole (PubChem CID 130209837) has the molecular formula C20H31NO5 and a molecular weight of 365.47 g/mol. Its IUPAC name is 5-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]-2,3,3-trimethylindole.
| Compound Name | 5-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]-2,3,3-trimethylindole |
|---|---|
| PubChem CID | 130209837 |
| Molecular Formula | C20H31NO5 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | 5-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]-2,3,3-trimethylindole |
| SMILES | COCCOCCOCCOCCOc1ccc2c(c1)C(C)(C)C(C)=N2 |
| InChI | InChI=1S/C20H31NO5/c1-16-20(2,3)18-15-17(5-6-19(18)21-16)26-14-13-25-12-11-24-10-9-23-8-7-22-4/h5-6,15H,7-14H2,1-4H3 |
| InChIKey | YCVYLTVBALHXEK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 58.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|