C8H11O8P — CID 130211072
(3R)-3-(3-carboxypropanoyloxy)-4-oxo-4-phosphanyloxybutanoic acid (PubChem CID 130211072) has the molecular formula C8H11O8P and a molecular weight of 266.14 g/mol. Its IUPAC name is (3R)-3-(3-carboxypropanoyloxy)-4-oxo-4-phosphanyloxybutanoic acid.
| Compound Name | (3R)-3-(3-carboxypropanoyloxy)-4-oxo-4-phosphanyloxybutanoic acid |
|---|---|
| PubChem CID | 130211072 |
| Molecular Formula | C8H11O8P |
| Molecular Weight | 266.14 g/mol |
| Exact Mass | 266.02 |
| IUPAC Name | (3R)-3-(3-carboxypropanoyloxy)-4-oxo-4-phosphanyloxybutanoic acid |
| SMILES | O=C(O)CCC(=O)O[C@H](CC(=O)O)C(=O)OP |
| InChI | InChI=1S/C8H11O8P/c9-5(10)1-2-7(13)15-4(3-6(11)12)8(14)16-17/h4H,1-3,17H2,(H,9,10)(H,11,12)/t4-/m1/s1 |
| InChIKey | GMTXPPMAUUADHE-SCSAIBSYSA-N |
| XLogP | -0.43 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.14 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|