About N,N-dimethyl-3-propan-2-ylcyclohexa-2,4-dien-1-amine
N,N-dimethyl-3-propan-2-ylcyclohexa-2,4-dien-1-amine (PubChem CID 130224295) has the molecular formula C11H19N
and a molecular weight of 165.28 g/mol. Its IUPAC name is N,N-dimethyl-3-propan-2-ylcyclohexa-2,4-dien-1-amine.
Analyze N,N-dimethyl-3-propan-2-ylcyclohexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-3-propan-2-ylcyclohexa-2,4-dien-1-amine?
The IUPAC name of N,N-dimethyl-3-propan-2-ylcyclohexa-2,4-dien-1-amine (CID 130224295) is N,N-dimethyl-3-propan-2-ylcyclohexa-2,4-dien-1-amine.
What is the SMILES notation for N,N-dimethyl-3-propan-2-ylcyclohexa-2,4-dien-1-amine?
The canonical SMILES for N,N-dimethyl-3-propan-2-ylcyclohexa-2,4-dien-1-amine is CC(C)C1=CC(N(C)C)CC=C1.
What is the InChIKey of N,N-dimethyl-3-propan-2-ylcyclohexa-2,4-dien-1-amine?
The InChIKey is LGXAMSZMMRHSKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N/c1-9(2)10-6-5-7-11(8-10)12(3)4/h5-6,8-9,11H,7H2,1-4H3.
What are the key properties of N,N-dimethyl-3-propan-2-ylcyclohexa-2,4-dien-1-amine?
N,N-dimethyl-3-propan-2-ylcyclohexa-2,4-dien-1-amine has a molecular weight of 165.28 g/mol, XLogP of 2.46, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-3-propan-2-ylcyclohexa-2,4-dien-1-amine is sourced from PubChem (CID 130224295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).