C12H18FN — CID 130224455
3-fluoro-N,5-di(propan-2-yl)aniline (PubChem CID 130224455) has the molecular formula C12H18FN and a molecular weight of 195.28 g/mol. Its IUPAC name is 3-fluoro-N,5-di(propan-2-yl)aniline.
| Compound Name | 3-fluoro-N,5-di(propan-2-yl)aniline |
|---|---|
| PubChem CID | 130224455 |
| Molecular Formula | C12H18FN |
| Molecular Weight | 195.28 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 3-fluoro-N,5-di(propan-2-yl)aniline |
| SMILES | CC(C)Nc1cc(F)cc(C(C)C)c1 |
| InChI | InChI=1S/C12H18FN/c1-8(2)10-5-11(13)7-12(6-10)14-9(3)4/h5-9,14H,1-4H3 |
| InChIKey | HESOICALYSLXKY-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.28 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |