C21H32O5 — CID 130227781
(3'aS,4'R,5'S,7'aS)-5'-[(1S,2R,5S,7R)-7-hydroxy-2-methyl-6-oxabicyclo[3.2.1]octan-2-yl]-7'a-methylspiro[1,3-dioxolane-2,1'-3,3a,4,5,6,7-hexahydro-2H-indene]-4'-carbaldehyde (PubChem CID 130227781) has the molecular formula C21H32O5 and a molecular weight of 364.48 g/mol. Its IUPAC name is (3'aS,4'R,5'S,7'aS)-5'-[(1S,2R,5S,7R)-7-hydroxy-2-methyl-6-oxabicyclo[3.2.1]octan-2-yl]-7'a-methylspiro[1,3-dioxolane-2,1'-3,3a,4,5,6,7-hexahydro-2H-indene]-4'-carbaldehyde.
| Compound Name | (3'aS,4'R,5'S,7'aS)-5'-[(1S,2R,5S,7R)-7-hydroxy-2-methyl-6-oxabicyclo[3.2.1]octan-2-yl]-7'a-methylspiro[1,3-dioxolane-2,1'-3,3a,4,5,6,7-hexahydro-2H-indene]-4'-carbaldehyde |
|---|---|
| PubChem CID | 130227781 |
| Molecular Formula | C21H32O5 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | (3'aS,4'R,5'S,7'aS)-5'-[(1S,2R,5S,7R)-7-hydroxy-2-methyl-6-oxabicyclo[3.2.1]octan-2-yl]-7'a-methylspiro[1,3-dioxolane-2,1'-3,3a,4,5,6,7-hexahydro-2H-indene]-4'-carbaldehyde |
| SMILES | C[C@]1([C@H]2CC[C@@]3(C)[C@@H](CCC34OCCO4)[C@@H]2C=O)CC[C@H]2C[C@@H]1[C@H](O)O2 |
| InChI | InChI=1S/C21H32O5/c1-19(6-3-13-11-17(19)18(23)26-13)15-4-7-20(2)16(14(15)12-22)5-8-21(20)24-9-10-25-21/h12-18,23H,3-11H2,1-2H3/t13-,14+,15-,16-,17+,18+,19+,20-/m0/s1 |
| InChIKey | IFZRGTKVTJXKFV-VKCHCZRYSA-N |
| XLogP | 2.89 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|