C20H30O3 — CID 140798767
(3aS,4R,5S,7aS)-5-[(1S,2R,5S)-7-hydroxy-2-methyl-6-oxabicyclo[3.2.1]octan-2-yl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-indene-4-carbaldehyde (PubChem CID 140798767) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (3aS,4R,5S,7aS)-5-[(1S,2R,5S)-7-hydroxy-2-methyl-6-oxabicyclo[3.2.1]octan-2-yl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-indene-4-carbaldehyde.
| Compound Name | (3aS,4R,5S,7aS)-5-[(1S,2R,5S)-7-hydroxy-2-methyl-6-oxabicyclo[3.2.1]octan-2-yl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-indene-4-carbaldehyde |
|---|---|
| PubChem CID | 140798767 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (3aS,4R,5S,7aS)-5-[(1S,2R,5S)-7-hydroxy-2-methyl-6-oxabicyclo[3.2.1]octan-2-yl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-indene-4-carbaldehyde |
| SMILES | C=C1CC[C@H]2[C@H](C=O)[C@@H]([C@@]3(C)CC[C@H]4C[C@@H]3C(O)O4)CC[C@]12C |
| InChI | InChI=1S/C20H30O3/c1-12-4-5-15-14(11-21)16(7-9-19(12,15)2)20(3)8-6-13-10-17(20)18(22)23-13/h11,13-18,22H,1,4-10H2,2-3H3/t13-,14-,15-,16-,17+,18?,19+,20+/m0/s1 |
| InChIKey | APHHVLGTVMYMRE-ZRNYCUNTSA-N |
| XLogP | 3.71 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|