C11H19N — CID 130239325
1-(2,6-dimethylcyclohex-3-en-1-yl)-N-methylethanimine (PubChem CID 130239325) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is 1-(2,6-dimethylcyclohex-3-en-1-yl)-N-methylethanimine.
| Compound Name | 1-(2,6-dimethylcyclohex-3-en-1-yl)-N-methylethanimine |
|---|---|
| PubChem CID | 130239325 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | 1-(2,6-dimethylcyclohex-3-en-1-yl)-N-methylethanimine |
| SMILES | C/N=C(\C)C1C(C)C=CCC1C |
| InChI | InChI=1S/C11H19N/c1-8-6-5-7-9(2)11(8)10(3)12-4/h5-6,8-9,11H,7H2,1-4H3/b12-10+ |
| InChIKey | VLCFEKPYEVDMLJ-ZRDIBKRKSA-N |
| XLogP | 2.93 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|