C10H14F3N — CID 130242697
(2Z,4E,6E)-8,8,8-trifluoro-3,7-dimethylocta-2,4,6-trien-4-amine (PubChem CID 130242697) has the molecular formula C10H14F3N and a molecular weight of 205.22 g/mol. Its IUPAC name is (2Z,4E,6E)-8,8,8-trifluoro-3,7-dimethylocta-2,4,6-trien-4-amine.
| Compound Name | (2Z,4E,6E)-8,8,8-trifluoro-3,7-dimethylocta-2,4,6-trien-4-amine |
|---|---|
| PubChem CID | 130242697 |
| Molecular Formula | C10H14F3N |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | (2Z,4E,6E)-8,8,8-trifluoro-3,7-dimethylocta-2,4,6-trien-4-amine |
| SMILES | C/C=C(C)\C(N)=C/C=C(\C)C(F)(F)F |
| InChI | InChI=1S/C10H14F3N/c1-4-7(2)9(14)6-5-8(3)10(11,12)13/h4-6H,14H2,1-3H3/b7-4-,8-5+,9-6+ |
| InChIKey | IGQIFHGKTFLWMD-OQMAIZNUSA-N |
| XLogP | 3.30 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|