About chloro-dimethyl-[3-[4-(1-phenylethenyl)phenyl]propyl]-λ4-sulfane
chloro-dimethyl-[3-[4-(1-phenylethenyl)phenyl]propyl]-λ4-sulfane (PubChem CID 130246551) has the molecular formula C19H23ClS
and a molecular weight of 318.91 g/mol. Its IUPAC name is chloro-dimethyl-[3-[4-(1-phenylethenyl)phenyl]propyl]-λ4-sulfane.
Molecular Properties
| Compound Name | chloro-dimethyl-[3-[4-(1-phenylethenyl)phenyl]propyl]-λ4-sulfane |
| PubChem CID | 130246551 |
| Molecular Formula | C19H23ClS |
| Molecular Weight | 318.91 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | chloro-dimethyl-[3-[4-(1-phenylethenyl)phenyl]propyl]-λ4-sulfane |
| SMILES | C=C(c1ccccc1)c1ccc(CCCS(C)(C)Cl)cc1 |
| InChI | InChI=1S/C19H23ClS/c1-16(18-9-5-4-6-10-18)19-13-11-17(12-14-19)8-7-15-21(2,3)20/h4-6,9-14H,1,7-8,15H2,2-3H3 |
| InChIKey | UTIVQECHHSCRJO-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 318.91 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze chloro-dimethyl-[3-[4-(1-phenylethenyl)phenyl]propyl]-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro-dimethyl-[3-[4-(1-phenylethenyl)phenyl]propyl]-λ4-sulfane?
The IUPAC name of chloro-dimethyl-[3-[4-(1-phenylethenyl)phenyl]propyl]-λ4-sulfane (CID 130246551) is chloro-dimethyl-[3-[4-(1-phenylethenyl)phenyl]propyl]-λ4-sulfane.
What is the SMILES notation for chloro-dimethyl-[3-[4-(1-phenylethenyl)phenyl]propyl]-λ4-sulfane?
The canonical SMILES for chloro-dimethyl-[3-[4-(1-phenylethenyl)phenyl]propyl]-λ4-sulfane is C=C(c1ccccc1)c1ccc(CCCS(C)(C)Cl)cc1.
What is the InChIKey of chloro-dimethyl-[3-[4-(1-phenylethenyl)phenyl]propyl]-λ4-sulfane?
The InChIKey is UTIVQECHHSCRJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23ClS/c1-16(18-9-5-4-6-10-18)19-13-11-17(12-14-19)8-7-15-21(2,3)20/h4-6,9-14H,1,7-8,15H2,2-3H3.
What are the key properties of chloro-dimethyl-[3-[4-(1-phenylethenyl)phenyl]propyl]-λ4-sulfane?
chloro-dimethyl-[3-[4-(1-phenylethenyl)phenyl]propyl]-λ4-sulfane has a molecular weight of 318.91 g/mol, XLogP of 5.90, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chloro-dimethyl-[3-[4-(1-phenylethenyl)phenyl]propyl]-λ4-sulfane is sourced from PubChem (CID 130246551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).