C20H26O2 — CID 130246958
(2S)-2-[(3-phenyl-1-adamantyl)methoxymethyl]oxirane (PubChem CID 130246958) has the molecular formula C20H26O2 and a molecular weight of 298.43 g/mol. Its IUPAC name is (2S)-2-[(3-phenyl-1-adamantyl)methoxymethyl]oxirane.
| Compound Name | (2S)-2-[(3-phenyl-1-adamantyl)methoxymethyl]oxirane |
|---|---|
| PubChem CID | 130246958 |
| Molecular Formula | C20H26O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | (2S)-2-[(3-phenyl-1-adamantyl)methoxymethyl]oxirane |
| SMILES | c1ccc(C23CC4CC(CC(COC[C@@H]5CO5)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C20H26O2/c1-2-4-17(5-3-1)20-9-15-6-16(10-20)8-19(7-15,13-20)14-21-11-18-12-22-18/h1-5,15-16,18H,6-14H2/t15?,16?,18-,19?,20?/m1/s1 |
| InChIKey | DZJADWDRRJVKSM-KHBRHUOASA-N |
| XLogP | 3.94 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|