C27H29FN4O2 — CID 130252569
(1S,3S,4S,5R,6S)-N-[(1S)-1-cyano-2-[2-fluoro-4-(2-methyl-1-oxo-3H-isoindol-5-yl)phenyl]ethyl]-5,6-dimethyl-2-azabicyclo[2.2.1]heptane-3-carboxamide (PubChem CID 130252569) has the molecular formula C27H29FN4O2 and a molecular weight of 460.55 g/mol. Its IUPAC name is (1S,3S,4S,5R,6S)-N-[(1S)-1-cyano-2-[2-fluoro-4-(2-methyl-1-oxo-3H-isoindol-5-yl)phenyl]ethyl]-5,6-dimethyl-2-azabicyclo[2.2.1]heptane-3-carboxamide.
| Compound Name | (1S,3S,4S,5R,6S)-N-[(1S)-1-cyano-2-[2-fluoro-4-(2-methyl-1-oxo-3H-isoindol-5-yl)phenyl]ethyl]-5,6-dimethyl-2-azabicyclo[2.2.1]heptane-3-carboxamide |
|---|---|
| PubChem CID | 130252569 |
| Molecular Formula | C27H29FN4O2 |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | (1S,3S,4S,5R,6S)-N-[(1S)-1-cyano-2-[2-fluoro-4-(2-methyl-1-oxo-3H-isoindol-5-yl)phenyl]ethyl]-5,6-dimethyl-2-azabicyclo[2.2.1]heptane-3-carboxamide |
| SMILES | C[C@@H]1[C@H](C)[C@@H]2C[C@@H]1[C@@H](C(=O)N[C@H](C#N)Cc1ccc(-c3ccc4c(c3)CN(C)C4=O)cc1F)N2 |
| InChI | InChI=1S/C27H29FN4O2/c1-14-15(2)24-11-22(14)25(31-24)26(33)30-20(12-29)9-18-5-4-17(10-23(18)28)16-6-7-21-19(8-16)13-32(3)27(21)34/h4-8,10,14-15,20,22,24-25,31H,9,11,13H2,1-3H3,(H,30,33)/t14-,15+,20+,22+,24+,25+/m1/s1 |
| InChIKey | IVKNLDGDPAMUAB-ZPQHYGCLSA-N |
| XLogP | 3.26 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |