C24H24FN3O3S — CID 146573795
methyl 4-[4-[(2S)-2-cyano-2-[[(1R,2S,3S,4S,5S,7S)-3-methyl-6-azatricyclo[3.2.1.02,4]octane-7-carbonyl]amino]ethyl]-3-fluorophenyl]thiophene-2-carboxylate (PubChem CID 146573795) has the molecular formula C24H24FN3O3S and a molecular weight of 453.54 g/mol. Its IUPAC name is methyl 4-[4-[(2S)-2-cyano-2-[[(1R,2S,3S,4S,5S,7S)-3-methyl-6-azatricyclo[3.2.1.02,4]octane-7-carbonyl]amino]ethyl]-3-fluorophenyl]thiophene-2-carboxylate.
| Compound Name | methyl 4-[4-[(2S)-2-cyano-2-[[(1R,2S,3S,4S,5S,7S)-3-methyl-6-azatricyclo[3.2.1.02,4]octane-7-carbonyl]amino]ethyl]-3-fluorophenyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 146573795 |
| Molecular Formula | C24H24FN3O3S |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | methyl 4-[4-[(2S)-2-cyano-2-[[(1R,2S,3S,4S,5S,7S)-3-methyl-6-azatricyclo[3.2.1.02,4]octane-7-carbonyl]amino]ethyl]-3-fluorophenyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1cc(-c2ccc(C[C@@H](C#N)NC(=O)[C@H]3N[C@H]4C[C@@H]3[C@@H]3[C@H](C)[C@@H]34)c(F)c2)cs1 |
| InChI | InChI=1S/C24H24FN3O3S/c1-11-20-16-8-18(21(11)20)28-22(16)23(29)27-15(9-26)5-13-4-3-12(6-17(13)25)14-7-19(32-10-14)24(30)31-2/h3-4,6-7,10-11,15-16,18,20-22,28H,5,8H2,1-2H3,(H,27,29)/t11-,15-,16+,18-,20-,21+,22-/m0/s1 |
| InChIKey | BXIZYKZZTNOTNQ-LBRWYXSASA-N |
| XLogP | 3.13 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |