C25H28FN3O3S — CID 130252937
(1S,3S,4S,5R,6S)-N-[(1S)-1-cyano-2-[2-fluoro-4-(4-methylsulfonylphenyl)phenyl]ethyl]-5,6-dimethyl-2-azabicyclo[2.2.1]heptane-3-carboxamide (PubChem CID 130252937) has the molecular formula C25H28FN3O3S and a molecular weight of 469.58 g/mol. Its IUPAC name is (1S,3S,4S,5R,6S)-N-[(1S)-1-cyano-2-[2-fluoro-4-(4-methylsulfonylphenyl)phenyl]ethyl]-5,6-dimethyl-2-azabicyclo[2.2.1]heptane-3-carboxamide.
| Compound Name | (1S,3S,4S,5R,6S)-N-[(1S)-1-cyano-2-[2-fluoro-4-(4-methylsulfonylphenyl)phenyl]ethyl]-5,6-dimethyl-2-azabicyclo[2.2.1]heptane-3-carboxamide |
|---|---|
| PubChem CID | 130252937 |
| Molecular Formula | C25H28FN3O3S |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | (1S,3S,4S,5R,6S)-N-[(1S)-1-cyano-2-[2-fluoro-4-(4-methylsulfonylphenyl)phenyl]ethyl]-5,6-dimethyl-2-azabicyclo[2.2.1]heptane-3-carboxamide |
| SMILES | C[C@@H]1[C@H](C)[C@@H]2C[C@@H]1[C@@H](C(=O)N[C@H](C#N)Cc1ccc(-c3ccc(S(C)(=O)=O)cc3)cc1F)N2 |
| InChI | InChI=1S/C25H28FN3O3S/c1-14-15(2)23-12-21(14)24(29-23)25(30)28-19(13-27)10-18-5-4-17(11-22(18)26)16-6-8-20(9-7-16)33(3,31)32/h4-9,11,14-15,19,21,23-24,29H,10,12H2,1-3H3,(H,28,30)/t14-,15+,19+,21+,23+,24+/m1/s1 |
| InChIKey | WXOPYESVTUNJNM-SOFCSZEPSA-N |
| XLogP | 3.08 |
| TPSA | 99.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |