C23H22FN3O3S — CID 155276346
4-[4-[(2S)-2-cyano-2-[[(1R,2S,3S,4S,5S,7S)-3-methyl-6-azatricyclo[3.2.1.02,4]octane-7-carbonyl]amino]ethyl]-3-fluorophenyl]thiophene-2-carboxylic acid (PubChem CID 155276346) has the molecular formula C23H22FN3O3S and a molecular weight of 439.51 g/mol. Its IUPAC name is 4-[4-[(2S)-2-cyano-2-[[(1R,2S,3S,4S,5S,7S)-3-methyl-6-azatricyclo[3.2.1.02,4]octane-7-carbonyl]amino]ethyl]-3-fluorophenyl]thiophene-2-carboxylic acid.
| Compound Name | 4-[4-[(2S)-2-cyano-2-[[(1R,2S,3S,4S,5S,7S)-3-methyl-6-azatricyclo[3.2.1.02,4]octane-7-carbonyl]amino]ethyl]-3-fluorophenyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 155276346 |
| Molecular Formula | C23H22FN3O3S |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | 4-[4-[(2S)-2-cyano-2-[[(1R,2S,3S,4S,5S,7S)-3-methyl-6-azatricyclo[3.2.1.02,4]octane-7-carbonyl]amino]ethyl]-3-fluorophenyl]thiophene-2-carboxylic acid |
| SMILES | C[C@H]1[C@H]2[C@H]3C[C@H](N[C@@H]3C(=O)N[C@H](C#N)Cc3ccc(-c4csc(C(=O)O)c4)cc3F)[C@@H]12 |
| InChI | InChI=1S/C23H22FN3O3S/c1-10-19-15-7-17(20(10)19)27-21(15)22(28)26-14(8-25)4-12-3-2-11(5-16(12)24)13-6-18(23(29)30)31-9-13/h2-3,5-6,9-10,14-15,17,19-21,27H,4,7H2,1H3,(H,26,28)(H,29,30)/t10-,14-,15+,17-,19-,20+,21-/m0/s1 |
| InChIKey | AXZRTGNXPTYJHI-GEDUOSDPSA-N |
| XLogP | 3.05 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |