About 7-oxooctan-2-yl 2-ethylbutanoate
7-oxooctan-2-yl 2-ethylbutanoate (PubChem CID 130260747) has the molecular formula C14H26O3
and a molecular weight of 242.36 g/mol. Its IUPAC name is 7-oxooctan-2-yl 2-ethylbutanoate.
Molecular Properties
| Compound Name | 7-oxooctan-2-yl 2-ethylbutanoate |
| PubChem CID | 130260747 |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | 7-oxooctan-2-yl 2-ethylbutanoate |
| SMILES | CCC(CC)C(=O)OC(C)CCCCC(C)=O |
| InChI | InChI=1S/C14H26O3/c1-5-13(6-2)14(16)17-12(4)10-8-7-9-11(3)15/h12-13H,5-10H2,1-4H3 |
| InChIKey | UZRITYBNUFEICF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-oxooctan-2-yl 2-ethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-oxooctan-2-yl 2-ethylbutanoate?
The IUPAC name of 7-oxooctan-2-yl 2-ethylbutanoate (CID 130260747) is 7-oxooctan-2-yl 2-ethylbutanoate.
What is the SMILES notation for 7-oxooctan-2-yl 2-ethylbutanoate?
The canonical SMILES for 7-oxooctan-2-yl 2-ethylbutanoate is CCC(CC)C(=O)OC(C)CCCCC(C)=O.
What is the InChIKey of 7-oxooctan-2-yl 2-ethylbutanoate?
The InChIKey is UZRITYBNUFEICF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O3/c1-5-13(6-2)14(16)17-12(4)10-8-7-9-11(3)15/h12-13H,5-10H2,1-4H3.
What are the key properties of 7-oxooctan-2-yl 2-ethylbutanoate?
7-oxooctan-2-yl 2-ethylbutanoate has a molecular weight of 242.36 g/mol, XLogP of 3.50, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-oxooctan-2-yl 2-ethylbutanoate is sourced from PubChem (CID 130260747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).