C24H18F7NO2 — CID 130261871
N-[4-[2-fluoro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]-3-phenylpropanamide (PubChem CID 130261871) has the molecular formula C24H18F7NO2 and a molecular weight of 485.40 g/mol. Its IUPAC name is N-[4-[2-fluoro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]-3-phenylpropanamide.
| Compound Name | N-[4-[2-fluoro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 130261871 |
| Molecular Formula | C24H18F7NO2 |
| Molecular Weight | 485.40 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | N-[4-[2-fluoro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]-3-phenylpropanamide |
| SMILES | O=C(CCc1ccccc1)Nc1ccc(-c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2F)cc1 |
| InChI | InChI=1S/C24H18F7NO2/c25-20-14-17(22(34,23(26,27)28)24(29,30)31)9-12-19(20)16-7-10-18(11-8-16)32-21(33)13-6-15-4-2-1-3-5-15/h1-5,7-12,14,34H,6,13H2,(H,32,33) |
| InChIKey | GACHCUZXVHXXQE-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.40 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |