C20H19F6NO2 — CID 11742811
2-cyclopentyl-N-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)naphthalen-1-yl]acetamide (PubChem CID 11742811) has the molecular formula C20H19F6NO2 and a molecular weight of 419.37 g/mol. Its IUPAC name is 2-cyclopentyl-N-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)naphthalen-1-yl]acetamide.
| Compound Name | 2-cyclopentyl-N-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)naphthalen-1-yl]acetamide |
|---|---|
| PubChem CID | 11742811 |
| Molecular Formula | C20H19F6NO2 |
| Molecular Weight | 419.37 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | 2-cyclopentyl-N-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)naphthalen-1-yl]acetamide |
| SMILES | O=C(CC1CCCC1)Nc1c(C(O)(C(F)(F)F)C(F)(F)F)ccc2ccccc12 |
| InChI | InChI=1S/C20H19F6NO2/c21-19(22,23)18(29,20(24,25)26)15-10-9-13-7-3-4-8-14(13)17(15)27-16(28)11-12-5-1-2-6-12/h3-4,7-10,12,29H,1-2,5-6,11H2,(H,27,28) |
| InChIKey | SQIOSKPMCKIBDS-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.37 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |