C20H16F7NO4 — CID 130263494
methyl 4-[4-[2-fluoro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]anilino]-4-oxobutanoate (PubChem CID 130263494) has the molecular formula C20H16F7NO4 and a molecular weight of 467.34 g/mol. Its IUPAC name is methyl 4-[4-[2-fluoro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]anilino]-4-oxobutanoate.
| Compound Name | methyl 4-[4-[2-fluoro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]anilino]-4-oxobutanoate |
|---|---|
| PubChem CID | 130263494 |
| Molecular Formula | C20H16F7NO4 |
| Molecular Weight | 467.34 g/mol |
| Exact Mass | 467.10 |
| IUPAC Name | methyl 4-[4-[2-fluoro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]anilino]-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)Nc1ccc(-c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2F)cc1 |
| InChI | InChI=1S/C20H16F7NO4/c1-32-17(30)9-8-16(29)28-13-5-2-11(3-6-13)14-7-4-12(10-15(14)21)18(31,19(22,23)24)20(25,26)27/h2-7,10,31H,8-9H2,1H3,(H,28,29) |
| InChIKey | QRNIAQAINCIHGV-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.34 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |