C21H20F7NO2 — CID 130262004
N-[4-[2-fluoro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]hexanamide (PubChem CID 130262004) has the molecular formula C21H20F7NO2 and a molecular weight of 451.38 g/mol. Its IUPAC name is N-[4-[2-fluoro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]hexanamide.
| Compound Name | N-[4-[2-fluoro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]hexanamide |
|---|---|
| PubChem CID | 130262004 |
| Molecular Formula | C21H20F7NO2 |
| Molecular Weight | 451.38 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | N-[4-[2-fluoro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]hexanamide |
| SMILES | CCCCCC(=O)Nc1ccc(-c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2F)cc1 |
| InChI | InChI=1S/C21H20F7NO2/c1-2-3-4-5-18(30)29-15-9-6-13(7-10-15)16-11-8-14(12-17(16)22)19(31,20(23,24)25)21(26,27)28/h6-12,31H,2-5H2,1H3,(H,29,30) |
| InChIKey | ATQDEGXITFOUNU-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.38 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|