C19H13F10NO2 — CID 130262024
4,4,4-trifluoro-N-[4-[2-fluoro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]butanamide (PubChem CID 130262024) has the molecular formula C19H13F10NO2 and a molecular weight of 477.30 g/mol. Its IUPAC name is 4,4,4-trifluoro-N-[4-[2-fluoro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]butanamide.
| Compound Name | 4,4,4-trifluoro-N-[4-[2-fluoro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]butanamide |
|---|---|
| PubChem CID | 130262024 |
| Molecular Formula | C19H13F10NO2 |
| Molecular Weight | 477.30 g/mol |
| Exact Mass | 477.08 |
| IUPAC Name | 4,4,4-trifluoro-N-[4-[2-fluoro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]butanamide |
| SMILES | O=C(CCC(F)(F)F)Nc1ccc(-c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2F)cc1 |
| InChI | InChI=1S/C19H13F10NO2/c20-14-9-11(17(32,18(24,25)26)19(27,28)29)3-6-13(14)10-1-4-12(5-2-10)30-15(31)7-8-16(21,22)23/h1-6,9,32H,7-8H2,(H,30,31) |
| InChIKey | KIEKUFHUMVYJEP-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.30 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |