C5HF12N — CID 130272456
1,1,2,2,3,3-hexafluoro-N,N-bis(trifluoromethyl)propan-1-amine (PubChem CID 130272456) has the molecular formula C5HF12N and a molecular weight of 303.05 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-N,N-bis(trifluoromethyl)propan-1-amine.
| Compound Name | 1,1,2,2,3,3-hexafluoro-N,N-bis(trifluoromethyl)propan-1-amine |
|---|---|
| PubChem CID | 130272456 |
| Molecular Formula | C5HF12N |
| Molecular Weight | 303.05 g/mol |
| Exact Mass | 302.99 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-N,N-bis(trifluoromethyl)propan-1-amine |
| SMILES | FC(F)C(F)(F)C(F)(F)N(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5HF12N/c6-1(7)2(8,9)3(10,11)18(4(12,13)14)5(15,16)17/h1H |
| InChIKey | CDRQKPHKFQVSTF-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.05 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|