C5H2F9NO2 — CID 91202349
fluoro(1,1,2,2,3,3,4,4-octafluorobutyl)carbamic acid (PubChem CID 91202349) has the molecular formula C5H2F9NO2 and a molecular weight of 279.06 g/mol. Its IUPAC name is fluoro(1,1,2,2,3,3,4,4-octafluorobutyl)carbamic acid.
| Compound Name | fluoro(1,1,2,2,3,3,4,4-octafluorobutyl)carbamic acid |
|---|---|
| PubChem CID | 91202349 |
| Molecular Formula | C5H2F9NO2 |
| Molecular Weight | 279.06 g/mol |
| Exact Mass | 278.99 |
| IUPAC Name | fluoro(1,1,2,2,3,3,4,4-octafluorobutyl)carbamic acid |
| SMILES | O=C(O)N(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C5H2F9NO2/c6-1(7)3(8,9)4(10,11)5(12,13)15(14)2(16)17/h1H,(H,16,17) |
| InChIKey | CNHQCANVLLHOBY-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.06 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|