C23H24FN3O5S — CID 130272588
(12S,17S)-N-[(4-fluorophenyl)methyl]-4-hydroxy-2,5-dioxo-10-sulfanyl-11-oxa-1,8-diazatetracyclo[8.8.0.03,8.012,17]octadeca-3,6-diene-6-carboxamide (PubChem CID 130272588) has the molecular formula C23H24FN3O5S and a molecular weight of 473.53 g/mol. Its IUPAC name is (12S,17S)-N-[(4-fluorophenyl)methyl]-4-hydroxy-2,5-dioxo-10-sulfanyl-11-oxa-1,8-diazatetracyclo[8.8.0.03,8.012,17]octadeca-3,6-diene-6-carboxamide.
| Compound Name | (12S,17S)-N-[(4-fluorophenyl)methyl]-4-hydroxy-2,5-dioxo-10-sulfanyl-11-oxa-1,8-diazatetracyclo[8.8.0.03,8.012,17]octadeca-3,6-diene-6-carboxamide |
|---|---|
| PubChem CID | 130272588 |
| Molecular Formula | C23H24FN3O5S |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | (12S,17S)-N-[(4-fluorophenyl)methyl]-4-hydroxy-2,5-dioxo-10-sulfanyl-11-oxa-1,8-diazatetracyclo[8.8.0.03,8.012,17]octadeca-3,6-diene-6-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1)c1cn2c(c(O)c1=O)C(=O)N1C[C@@H]3CCCC[C@@H]3OC1(S)C2 |
| InChI | InChI=1S/C23H24FN3O5S/c24-15-7-5-13(6-8-15)9-25-21(30)16-11-26-12-23(33)27(22(31)18(26)20(29)19(16)28)10-14-3-1-2-4-17(14)32-23/h5-8,11,14,17,29,33H,1-4,9-10,12H2,(H,25,30)/t14-,17-,23?/m0/s1 |
| InChIKey | PKRPQCZWXRCEKG-HFXFBWPRSA-N |
| XLogP | 2.25 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|