C11H16ClN5O2 — CID 130284110
tert-butyl N-[2-(3-chloro-6-iminopyridazin-1-yl)-2-iminoethyl]carbamate (PubChem CID 130284110) has the molecular formula C11H16ClN5O2 and a molecular weight of 285.73 g/mol. Its IUPAC name is tert-butyl N-[2-(3-chloro-6-iminopyridazin-1-yl)-2-iminoethyl]carbamate.
| Compound Name | tert-butyl N-[2-(3-chloro-6-iminopyridazin-1-yl)-2-iminoethyl]carbamate |
|---|---|
| PubChem CID | 130284110 |
| Molecular Formula | C11H16ClN5O2 |
| Molecular Weight | 285.73 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | tert-butyl N-[2-(3-chloro-6-iminopyridazin-1-yl)-2-iminoethyl]carbamate |
| SMILES | [H]/N=C(\CNC(=O)OC(C)(C)C)n1nc(Cl)cc/c1=N\[H] |
| InChI | InChI=1S/C11H16ClN5O2/c1-11(2,3)19-10(18)15-6-9(14)17-8(13)5-4-7(12)16-17/h4-5,13-14H,6H2,1-3H3,(H,15,18)/b13-8+,14-9+ |
| InChIKey | DYHMZDPGICLABV-UQNWOCKMSA-N |
| XLogP | 1.37 |
| TPSA | 103.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.73 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|