C15H23Cl2N5O2 — CID 155067163
tert-butyl N-[4-[4-carbonochloridimidoyl-5-(1-chloroethenylamino)imidazol-1-yl]butyl]carbamate (PubChem CID 155067163) has the molecular formula C15H23Cl2N5O2 and a molecular weight of 376.29 g/mol. Its IUPAC name is tert-butyl N-[4-[4-carbonochloridimidoyl-5-(1-chloroethenylamino)imidazol-1-yl]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[4-carbonochloridimidoyl-5-(1-chloroethenylamino)imidazol-1-yl]butyl]carbamate |
|---|---|
| PubChem CID | 155067163 |
| Molecular Formula | C15H23Cl2N5O2 |
| Molecular Weight | 376.29 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | tert-butyl N-[4-[4-carbonochloridimidoyl-5-(1-chloroethenylamino)imidazol-1-yl]butyl]carbamate |
| SMILES | [H]/N=C(\Cl)c1ncn(CCCCNC(=O)OC(C)(C)C)c1NC(=C)Cl |
| InChI | InChI=1S/C15H23Cl2N5O2/c1-10(16)21-13-11(12(17)18)20-9-22(13)8-6-5-7-19-14(23)24-15(2,3)4/h9,18,21H,1,5-8H2,2-4H3,(H,19,23)/b18-12- |
| InChIKey | DNLGOKVMPMZJDE-PDGQHHTCSA-N |
| XLogP | 3.87 |
| TPSA | 92.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.29 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|