C18H14O6 — CID 130294759
2-(9,10-dioxoanthracen-2-yl)-3-hydroxy-2-(hydroxymethyl)propanoic acid (PubChem CID 130294759) has the molecular formula C18H14O6 and a molecular weight of 326.30 g/mol. Its IUPAC name is 2-(9,10-dioxoanthracen-2-yl)-3-hydroxy-2-(hydroxymethyl)propanoic acid.
| Compound Name | 2-(9,10-dioxoanthracen-2-yl)-3-hydroxy-2-(hydroxymethyl)propanoic acid |
|---|---|
| PubChem CID | 130294759 |
| Molecular Formula | C18H14O6 |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 2-(9,10-dioxoanthracen-2-yl)-3-hydroxy-2-(hydroxymethyl)propanoic acid |
| SMILES | O=C1c2ccccc2C(=O)c2cc(C(CO)(CO)C(=O)O)ccc21 |
| InChI | InChI=1S/C18H14O6/c19-8-18(9-20,17(23)24)10-5-6-13-14(7-10)16(22)12-4-2-1-3-11(12)15(13)21/h1-7,19-20H,8-9H2,(H,23,24) |
| InChIKey | RESYNLFGDAUFNS-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|