C18H22N2O2S2 — CID 130300545
(2S,4R)-4-amino-2-methyl-5-[4-[(pyridin-2-yldisulfanyl)methyl]phenyl]pentanoic acid (PubChem CID 130300545) has the molecular formula C18H22N2O2S2 and a molecular weight of 362.52 g/mol. Its IUPAC name is (2S,4R)-4-amino-2-methyl-5-[4-[(pyridin-2-yldisulfanyl)methyl]phenyl]pentanoic acid.
| Compound Name | (2S,4R)-4-amino-2-methyl-5-[4-[(pyridin-2-yldisulfanyl)methyl]phenyl]pentanoic acid |
|---|---|
| PubChem CID | 130300545 |
| Molecular Formula | C18H22N2O2S2 |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | (2S,4R)-4-amino-2-methyl-5-[4-[(pyridin-2-yldisulfanyl)methyl]phenyl]pentanoic acid |
| SMILES | C[C@@H](C[C@@H](N)Cc1ccc(CSSc2ccccn2)cc1)C(=O)O |
| InChI | InChI=1S/C18H22N2O2S2/c1-13(18(21)22)10-16(19)11-14-5-7-15(8-6-14)12-23-24-17-4-2-3-9-20-17/h2-9,13,16H,10-12,19H2,1H3,(H,21,22)/t13-,16+/m0/s1 |
| InChIKey | PSQWSOZPHKTTMD-XJKSGUPXSA-N |
| XLogP | 4.00 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|