C16H14ClN3O4S — CID 130302615
[5-(5-chloro-2-methyl-1H-indol-3-yl)-3-pyridinyl]sulfonyl-methylcarbamic acid (PubChem CID 130302615) has the molecular formula C16H14ClN3O4S and a molecular weight of 379.83 g/mol. Its IUPAC name is [5-(5-chloro-2-methyl-1H-indol-3-yl)-3-pyridinyl]sulfonyl-methylcarbamic acid.
| Compound Name | [5-(5-chloro-2-methyl-1H-indol-3-yl)-3-pyridinyl]sulfonyl-methylcarbamic acid |
|---|---|
| PubChem CID | 130302615 |
| Molecular Formula | C16H14ClN3O4S |
| Molecular Weight | 379.83 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | [5-(5-chloro-2-methyl-1H-indol-3-yl)-3-pyridinyl]sulfonyl-methylcarbamic acid |
| SMILES | Cc1[nH]c2ccc(Cl)cc2c1-c1cncc(S(=O)(=O)N(C)C(=O)O)c1 |
| InChI | InChI=1S/C16H14ClN3O4S/c1-9-15(13-6-11(17)3-4-14(13)19-9)10-5-12(8-18-7-10)25(23,24)20(2)16(21)22/h3-8,19H,1-2H3,(H,21,22) |
| InChIKey | CJWBAPLVVPPHMQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 103.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.83 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |