C25H34N4O — CID 130306404
1-[(2S)-2-methylpiperidine-1-carboximidoyl]-5-[[(4S)-4-propyl-1,2,3,4-tetrahydronaphthalen-1-yl]oxy]pyridin-2-imine (PubChem CID 130306404) has the molecular formula C25H34N4O and a molecular weight of 406.57 g/mol. Its IUPAC name is 1-[(2S)-2-methylpiperidine-1-carboximidoyl]-5-[[(4S)-4-propyl-1,2,3,4-tetrahydronaphthalen-1-yl]oxy]pyridin-2-imine.
| Compound Name | 1-[(2S)-2-methylpiperidine-1-carboximidoyl]-5-[[(4S)-4-propyl-1,2,3,4-tetrahydronaphthalen-1-yl]oxy]pyridin-2-imine |
|---|---|
| PubChem CID | 130306404 |
| Molecular Formula | C25H34N4O |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | 1-[(2S)-2-methylpiperidine-1-carboximidoyl]-5-[[(4S)-4-propyl-1,2,3,4-tetrahydronaphthalen-1-yl]oxy]pyridin-2-imine |
| SMILES | [H]/N=C(\N1CCCC[C@@H]1C)n1cc(OC2CC[C@H](CCC)c3ccccc32)cc/c1=N\[H] |
| InChI | InChI=1S/C25H34N4O/c1-3-8-19-12-14-23(22-11-5-4-10-21(19)22)30-20-13-15-24(26)29(17-20)25(27)28-16-7-6-9-18(28)2/h4-5,10-11,13,15,17-19,23,26-27H,3,6-9,12,14,16H2,1-2H3/b26-24+,27-25+/t18-,19-,23?/m0/s1 |
| InChIKey | DBJSNIDBYJXFMY-VTTYNRKGSA-N |
| XLogP | 5.42 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|